About (5S)-5-methoxy-1,7-diphenylheptan-3-one
(5S)-5-methoxy-1,7-diphenylheptan-3-one (PubChem CID 26437440) has the molecular formula C20H24O2
and a molecular weight of 296.41 g/mol. Its IUPAC name is (5S)-5-methoxy-1,7-diphenylheptan-3-one.
Molecular Properties
| Compound Name | (5S)-5-methoxy-1,7-diphenylheptan-3-one |
| PubChem CID | 26437440 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (5S)-5-methoxy-1,7-diphenylheptan-3-one |
| SMILES | CO[C@@H](CCc1ccccc1)CC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H24O2/c1-22-20(15-13-18-10-6-3-7-11-18)16-19(21)14-12-17-8-4-2-5-9-17/h2-11,20H,12-16H2,1H3/t20-/m0/s1 |
| InChIKey | PVYORFBABSDDNC-FQEVSTJZSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-methoxy-1,7-diphenylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-methoxy-1,7-diphenylheptan-3-one?
The IUPAC name of (5S)-5-methoxy-1,7-diphenylheptan-3-one (CID 26437440) is (5S)-5-methoxy-1,7-diphenylheptan-3-one.
What is the SMILES notation for (5S)-5-methoxy-1,7-diphenylheptan-3-one?
The canonical SMILES for (5S)-5-methoxy-1,7-diphenylheptan-3-one is CO[C@@H](CCc1ccccc1)CC(=O)CCc1ccccc1.
What is the InChIKey of (5S)-5-methoxy-1,7-diphenylheptan-3-one?
The InChIKey is PVYORFBABSDDNC-FQEVSTJZSA-N. The full InChI is InChI=1S/C20H24O2/c1-22-20(15-13-18-10-6-3-7-11-18)16-19(21)14-12-17-8-4-2-5-9-17/h2-11,20H,12-16H2,1H3/t20-/m0/s1.
What are the key properties of (5S)-5-methoxy-1,7-diphenylheptan-3-one?
(5S)-5-methoxy-1,7-diphenylheptan-3-one has a molecular weight of 296.41 g/mol, XLogP of 4.23, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-methoxy-1,7-diphenylheptan-3-one is sourced from PubChem (CID 26437440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).