C20H24O2 — CID 26437441
(5R)-5-methoxy-1,7-diphenylheptan-3-one (PubChem CID 26437441) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (5R)-5-methoxy-1,7-diphenylheptan-3-one.
| Compound Name | (5R)-5-methoxy-1,7-diphenylheptan-3-one |
|---|---|
| PubChem CID | 26437441 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (5R)-5-methoxy-1,7-diphenylheptan-3-one |
| SMILES | CO[C@H](CCc1ccccc1)CC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H24O2/c1-22-20(15-13-18-10-6-3-7-11-18)16-19(21)14-12-17-8-4-2-5-9-17/h2-11,20H,12-16H2,1H3/t20-/m1/s1 |
| InChIKey | PVYORFBABSDDNC-HXUWFJFHSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |