About N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide (PubChem CID 2644561) has the molecular formula C15H24N4O3
and a molecular weight of 308.38 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide.
Molecular Properties
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide |
| PubChem CID | 2644561 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide |
| SMILES | CCCCn1c(N)c(N(CC)C(=O)C2CCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H24N4O3/c1-3-5-9-19-12(16)11(13(20)17-15(19)22)18(4-2)14(21)10-7-6-8-10/h10H,3-9,16H2,1-2H3,(H,17,20,22) |
| InChIKey | GHJAGTIBXSPZBP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide?
The IUPAC name of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide (CID 2644561) is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide.
What is the SMILES notation for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide?
The canonical SMILES for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide is CCCCn1c(N)c(N(CC)C(=O)C2CCC2)c(=O)[nH]c1=O.
What is the InChIKey of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide?
The InChIKey is GHJAGTIBXSPZBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O3/c1-3-5-9-19-12(16)11(13(20)17-15(19)22)18(4-2)14(21)10-7-6-8-10/h10H,3-9,16H2,1-2H3,(H,17,20,22).
What are the key properties of N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide?
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide has a molecular weight of 308.38 g/mol, XLogP of 1.07, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-ethylcyclobutanecarboxamide is sourced from PubChem (CID 2644561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).