C23H27N3O — CID 26447126
2,3-dimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1H-indole-5-carboxamide (PubChem CID 26447126) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 2,3-dimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 26447126 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 2,3-dimethyl-N-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)NCc3ccc(CN4CCCC4)cc3)cc2c1C |
| InChI | InChI=1S/C23H27N3O/c1-16-17(2)25-22-10-9-20(13-21(16)22)23(27)24-14-18-5-7-19(8-6-18)15-26-11-3-4-12-26/h5-10,13,25H,3-4,11-12,14-15H2,1-2H3,(H,24,27) |
| InChIKey | BUSOZPJYTTYELK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|