C17H18F3NO7 — CID 2645094
[2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate (PubChem CID 2645094) has the molecular formula C17H18F3NO7 and a molecular weight of 405.33 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate.
| Compound Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
|---|---|
| PubChem CID | 2645094 |
| Molecular Formula | C17H18F3NO7 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)-5-(trifluoromethyl)anilino]-2-oxoethyl] 2,3-dihydro-1,4-dioxine-5-carboxylate |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)COC(=O)C1=COCCO1 |
| InChI | InChI=1S/C17H18F3NO7/c1-24-4-6-26-13-3-2-11(17(18,19)20)8-12(13)21-15(22)10-28-16(23)14-9-25-5-7-27-14/h2-3,8-9H,4-7,10H2,1H3,(H,21,22) |
| InChIKey | AUKCFXVSXVVWAX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|