C17H13F6N3O4S — CID 26452971
1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine (PubChem CID 26452971) has the molecular formula C17H13F6N3O4S and a molecular weight of 469.36 g/mol. Its IUPAC name is 1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine.
| Compound Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 26452971 |
| Molecular Formula | C17H13F6N3O4S |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | 1-[2-nitro-4-(trifluoromethyl)phenyl]-4-(2,3,4-trifluorophenyl)sulfonylpiperazine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1N1CCN(S(=O)(=O)c2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C17H13F6N3O4S/c18-11-2-4-14(16(20)15(11)19)31(29,30)25-7-5-24(6-8-25)12-3-1-10(17(21,22)23)9-13(12)26(27)28/h1-4,9H,5-8H2 |
| InChIKey | UYJDNOGIHNCZEV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|