C24H21F3N6S — CID 26454123
10-pyridin-3-yl-12-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene (PubChem CID 26454123) has the molecular formula C24H21F3N6S and a molecular weight of 482.54 g/mol. Its IUPAC name is 10-pyridin-3-yl-12-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene.
| Compound Name | 10-pyridin-3-yl-12-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
|---|---|
| PubChem CID | 26454123 |
| Molecular Formula | C24H21F3N6S |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 10-pyridin-3-yl-12-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraene |
| SMILES | FC(F)(F)c1ccc(N2CCN(c3nc(-c4cccnc4)nc4sc5c(c34)CCC5)CC2)nc1 |
| InChI | InChI=1S/C24H21F3N6S/c25-24(26,27)16-6-7-19(29-14-16)32-9-11-33(12-10-32)22-20-17-4-1-5-18(17)34-23(20)31-21(30-22)15-3-2-8-28-13-15/h2-3,6-8,13-14H,1,4-5,9-12H2 |
| InChIKey | WCJISICVHMLNGQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |