C20H21N3O3 — CID 26456849
N-[2-(tert-butylamino)-2-oxoethyl]-2-(furan-2-yl)quinoline-4-carboxamide (PubChem CID 26456849) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-2-(furan-2-yl)quinoline-4-carboxamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-2-(furan-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 26456849 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-2-(furan-2-yl)quinoline-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)CNC(=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C20H21N3O3/c1-20(2,3)23-18(24)12-21-19(25)14-11-16(17-9-6-10-26-17)22-15-8-5-4-7-13(14)15/h4-11H,12H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | MZKQTCJSRAWECL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |