C16H25N3O — CID 26457997
(3R)-N,N-diethyl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide (PubChem CID 26457997) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is (3R)-N,N-diethyl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N,N-diethyl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26457997 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (3R)-N,N-diethyl-1-(pyridin-4-ylmethyl)piperidine-3-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CCCN(Cc2ccncc2)C1 |
| InChI | InChI=1S/C16H25N3O/c1-3-19(4-2)16(20)15-6-5-11-18(13-15)12-14-7-9-17-10-8-14/h7-10,15H,3-6,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | INEYFNKXQFNUJT-OAHLLOKOSA-N |
| XLogP | 2.16 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |