About 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide
1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide (PubChem CID 26458002) has the molecular formula C15H28N2O
and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide |
| PubChem CID | 26458002 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide |
| SMILES | CC(C)=CCC[C@H](C)CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H28N2O/c1-12(2)5-4-6-13(3)11-17-9-7-14(8-10-17)15(16)18/h5,13-14H,4,6-11H2,1-3H3,(H2,16,18)/t13-/m0/s1 |
| InChIKey | HOARYMSXLCHYIH-ZDUSSCGKSA-N |
| XLogP | 2.57 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide?
The IUPAC name of 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide (CID 26458002) is 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide.
What is the SMILES notation for 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide?
The canonical SMILES for 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide is CC(C)=CCC[C@H](C)CN1CCC(C(N)=O)CC1.
What is the InChIKey of 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide?
The InChIKey is HOARYMSXLCHYIH-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H28N2O/c1-12(2)5-4-6-13(3)11-17-9-7-14(8-10-17)15(16)18/h5,13-14H,4,6-11H2,1-3H3,(H2,16,18)/t13-/m0/s1.
What are the key properties of 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide?
1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide has a molecular weight of 252.40 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2,6-dimethylhept-5-enyl]piperidine-4-carboxamide is sourced from PubChem (CID 26458002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).