C9H12ClN — CID 26459
1,2,3,4-tetrahydroisoquinolin-2-ium chloride (PubChem CID 26459) has the molecular formula C9H12ClN and a molecular weight of 169.66 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinolin-2-ium chloride.
| Compound Name | 1,2,3,4-tetrahydroisoquinolin-2-ium chloride |
|---|---|
| PubChem CID | 26459 |
| Molecular Formula | C9H12ClN |
| Molecular Weight | 169.66 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinolin-2-ium chloride |
| SMILES | [Cl-].c1ccc2c(c1)CC[NH2+]C2 |
| InChI | InChI=1S/C9H11N.ClH/c1-2-4-9-7-10-6-5-8(9)3-1;/h1-4,10H,5-7H2;1H |
| InChIKey | MGFREDWKELGWML-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.66 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |