C25H24N2O2S — CID 26462653
N-phenyl-1-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]piperidine-4-carboxamide (PubChem CID 26462653) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is N-phenyl-1-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-phenyl-1-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26462653 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N-phenyl-1-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)/C=C/c2ccc(-c3ccccc3)s2)CC1 |
| InChI | InChI=1S/C25H24N2O2S/c28-24(14-12-22-11-13-23(30-22)19-7-3-1-4-8-19)27-17-15-20(16-18-27)25(29)26-21-9-5-2-6-10-21/h1-14,20H,15-18H2,(H,26,29)/b14-12+ |
| InChIKey | UQMDEOBRMAUQDV-WYMLVPIESA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|