About (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate
(2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate (PubChem CID 2646335) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate.
Molecular Properties
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate |
| PubChem CID | 2646335 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate |
| SMILES | O=C(OCC(=O)N1CCCC1)c1ccccc1O |
| InChI | InChI=1S/C13H15NO4/c15-11-6-2-1-5-10(11)13(17)18-9-12(16)14-7-3-4-8-14/h1-2,5-6,15H,3-4,7-9H2 |
| InChIKey | UNSYQJSBWSYIKI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate?
The IUPAC name of (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate (CID 2646335) is (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate.
What is the SMILES notation for (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate?
The canonical SMILES for (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate is O=C(OCC(=O)N1CCCC1)c1ccccc1O.
What is the InChIKey of (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate?
The InChIKey is UNSYQJSBWSYIKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c15-11-6-2-1-5-10(11)13(17)18-9-12(16)14-7-3-4-8-14/h1-2,5-6,15H,3-4,7-9H2.
What are the key properties of (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate?
(2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate has a molecular weight of 249.27 g/mol, XLogP of 1.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-2-pyrrolidin-1-ylethyl) 2-hydroxybenzoate is sourced from PubChem (CID 2646335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).