C22H28ClN3O — CID 26464004
2-chloro-N-[3-[(3-piperidin-1-ylpropylamino)methyl]phenyl]benzamide (PubChem CID 26464004) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is 2-chloro-N-[3-[(3-piperidin-1-ylpropylamino)methyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(3-piperidin-1-ylpropylamino)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 26464004 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-chloro-N-[3-[(3-piperidin-1-ylpropylamino)methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CNCCCN2CCCCC2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C22H28ClN3O/c23-21-11-3-2-10-20(21)22(27)25-19-9-6-8-18(16-19)17-24-12-7-15-26-13-4-1-5-14-26/h2-3,6,8-11,16,24H,1,4-5,7,12-15,17H2,(H,25,27) |
| InChIKey | SWBNFISFKPNXRV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|