C18H15Cl2N3O3 — CID 26465857
N-(3,5-dichlorophenyl)-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide (PubChem CID 26465857) has the molecular formula C18H15Cl2N3O3 and a molecular weight of 392.24 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide |
|---|---|
| PubChem CID | 26465857 |
| Molecular Formula | C18H15Cl2N3O3 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(3-ethyl-2,4-dioxoquinazolin-1-yl)acetamide |
| SMILES | CCn1c(=O)c2ccccc2n(CC(=O)Nc2cc(Cl)cc(Cl)c2)c1=O |
| InChI | InChI=1S/C18H15Cl2N3O3/c1-2-22-17(25)14-5-3-4-6-15(14)23(18(22)26)10-16(24)21-13-8-11(19)7-12(20)9-13/h3-9H,2,10H2,1H3,(H,21,24) |
| InChIKey | FGFDJZUFWBYHML-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |