C16H19N5O3S2 — CID 26466645
3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 26466645) has the molecular formula C16H19N5O3S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 26466645 |
| Molecular Formula | C16H19N5O3S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 3-(2-oxo-5-thiophen-2-yl-1,3,4-oxadiazol-3-yl)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCCCCc1nnc(NC(=O)CCn2nc(-c3cccs3)oc2=O)s1 |
| InChI | InChI=1S/C16H19N5O3S2/c1-2-3-4-7-13-18-19-15(26-13)17-12(22)8-9-21-16(23)24-14(20-21)11-6-5-10-25-11/h5-6,10H,2-4,7-9H2,1H3,(H,17,19,22) |
| InChIKey | WOOKBLPZYMKFHM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|