About 1,2-diphenylethanamine
1,2-diphenylethanamine (PubChem CID 26482) has the molecular formula C14H15N
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1,2-diphenylethanamine.
Molecular Properties
| Compound Name | 1,2-diphenylethanamine |
| PubChem CID | 26482 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1,2-diphenylethanamine |
| SMILES | NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15N/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14H,11,15H2 |
| InChIKey | DTGGNTMERRTPLR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-diphenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylethanamine?
The IUPAC name of 1,2-diphenylethanamine (CID 26482) is 1,2-diphenylethanamine.
What is the SMILES notation for 1,2-diphenylethanamine?
The canonical SMILES for 1,2-diphenylethanamine is NC(Cc1ccccc1)c1ccccc1.
What is the InChIKey of 1,2-diphenylethanamine?
The InChIKey is DTGGNTMERRTPLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N/c15-14(13-9-5-2-6-10-13)11-12-7-3-1-4-8-12/h1-10,14H,11,15H2.
What are the key properties of 1,2-diphenylethanamine?
1,2-diphenylethanamine has a molecular weight of 197.28 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylethanamine is sourced from PubChem (CID 26482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).