C22H29ClN2O5S — CID 26498058
(2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propan-2-ol (PubChem CID 26498058) has the molecular formula C22H29ClN2O5S and a molecular weight of 469.00 g/mol. Its IUPAC name is (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 26498058 |
| Molecular Formula | C22H29ClN2O5S |
| Molecular Weight | 469.00 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (2S)-1-[2-(4-chlorophenoxy)ethoxy]-3-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]propan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C[C@H](O)COCCOc3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H29ClN2O5S/c1-18-2-8-22(9-3-18)31(27,28)25-12-10-24(11-13-25)16-20(26)17-29-14-15-30-21-6-4-19(23)5-7-21/h2-9,20,26H,10-17H2,1H3/t20-/m0/s1 |
| InChIKey | IHHNZOCIAMESQP-FQEVSTJZSA-N |
| XLogP | 2.41 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.00 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|