About [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate
[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate (PubChem CID 2649845) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate.
Molecular Properties
| Compound Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate |
| PubChem CID | 2649845 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate |
| SMILES | CCCn1c(C)cc(C(=O)COC(=O)c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C19H20N2O3/c1-4-9-21-13(2)10-17(14(21)3)18(22)12-24-19(23)16-7-5-15(11-20)6-8-16/h5-8,10H,4,9,12H2,1-3H3 |
| InChIKey | YXXZQUVMMZFKDT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate?
The IUPAC name of [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate (CID 2649845) is [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate.
What is the SMILES notation for [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate?
The canonical SMILES for [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate is CCCn1c(C)cc(C(=O)COC(=O)c2ccc(C#N)cc2)c1C.
What is the InChIKey of [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate?
The InChIKey is YXXZQUVMMZFKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-4-9-21-13(2)10-17(14(21)3)18(22)12-24-19(23)16-7-5-15(11-20)6-8-16/h5-8,10H,4,9,12H2,1-3H3.
What are the key properties of [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate?
[2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate has a molecular weight of 324.38 g/mol, XLogP of 3.43, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethyl-1-propylpyrrol-3-yl)-2-oxoethyl] 4-cyanobenzoate is sourced from PubChem (CID 2649845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).