C16H14ClF3N2O3 — CID 26506775
2-(5-chloro-2-methoxyanilino)-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 26506775) has the molecular formula C16H14ClF3N2O3 and a molecular weight of 374.75 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyanilino)-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(5-chloro-2-methoxyanilino)-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 26506775 |
| Molecular Formula | C16H14ClF3N2O3 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-(5-chloro-2-methoxyanilino)-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | COc1ccc(Cl)cc1NCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14ClF3N2O3/c1-24-14-7-2-10(17)8-13(14)21-9-15(23)22-11-3-5-12(6-4-11)25-16(18,19)20/h2-8,21H,9H2,1H3,(H,22,23) |
| InChIKey | AONXNLBNKZDXQQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |