C14H20N2O3 — CID 26521
5,5-diethyl-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione (PubChem CID 26521) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5,5-diethyl-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 26521 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5,5-diethyl-1,3-bis(prop-2-enyl)-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)N(CC=C)C(=O)C(CC)(CC)C1=O |
| InChI | InChI=1S/C14H20N2O3/c1-5-9-15-11(17)14(7-3,8-4)12(18)16(10-6-2)13(15)19/h5-6H,1-2,7-10H2,3-4H3 |
| InChIKey | OQJNEKQRESAPIR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|