C19H22F2N2O4S — CID 26521263
N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(difluoromethoxy)benzamide (PubChem CID 26521263) has the molecular formula C19H22F2N2O4S and a molecular weight of 412.46 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(difluoromethoxy)benzamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 26521263 |
| Molecular Formula | C19H22F2N2O4S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-3-(difluoromethoxy)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)c2cccc(OC(F)F)c2)ccc1C |
| InChI | InChI=1S/C19H22F2N2O4S/c1-4-23(5-2)28(25,26)17-12-15(10-9-13(17)3)22-18(24)14-7-6-8-16(11-14)27-19(20)21/h6-12,19H,4-5H2,1-3H3,(H,22,24) |
| InChIKey | MHTJTYFZMKWCKF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |