C23H24ClN3O3S — CID 26525219
N-(4-chlorophenyl)-2-[(4R)-3-[2-(4-methoxyphenyl)ethyl]-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetamide (PubChem CID 26525219) has the molecular formula C23H24ClN3O3S and a molecular weight of 457.98 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(4R)-3-[2-(4-methoxyphenyl)ethyl]-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(4R)-3-[2-(4-methoxyphenyl)ethyl]-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 26525219 |
| Molecular Formula | C23H24ClN3O3S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(4R)-3-[2-(4-methoxyphenyl)ethyl]-5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl]acetamide |
| SMILES | C=CCN1C(=O)[C@@H](CC(=O)Nc2ccc(Cl)cc2)N(CCc2ccc(OC)cc2)C1=S |
| InChI | InChI=1S/C23H24ClN3O3S/c1-3-13-27-22(29)20(15-21(28)25-18-8-6-17(24)7-9-18)26(23(27)31)14-12-16-4-10-19(30-2)11-5-16/h3-11,20H,1,12-15H2,2H3,(H,25,28)/t20-/m1/s1 |
| InChIKey | YKMFJXMEWBVZBG-HXUWFJFHSA-N |
| XLogP | 3.90 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|