C26H23ClFN3O4 — CID 26525636
2-[(4S)-1-(3-chlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 26525636) has the molecular formula C26H23ClFN3O4 and a molecular weight of 495.94 g/mol. Its IUPAC name is 2-[(4S)-1-(3-chlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(4S)-1-(3-chlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 26525636 |
| Molecular Formula | C26H23ClFN3O4 |
| Molecular Weight | 495.94 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 2-[(4S)-1-(3-chlorophenyl)-3-[2-(4-methoxyphenyl)ethyl]-2,5-dioxoimidazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccc(CCN2C(=O)N(c3cccc(Cl)c3)C(=O)[C@@H]2CC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H23ClFN3O4/c1-35-22-11-5-17(6-12-22)13-14-30-23(16-24(32)29-20-9-7-19(28)8-10-20)25(33)31(26(30)34)21-4-2-3-18(27)15-21/h2-12,15,23H,13-14,16H2,1H3,(H,29,32)/t23-/m0/s1 |
| InChIKey | JLGXJGWIDLRPEK-QHCPKHFHSA-N |
| XLogP | 4.90 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|