C18H16N2O5S — CID 26528996
(2-methylquinolin-8-yl) 2,3-dimethyl-5-nitrobenzenesulfonate (PubChem CID 26528996) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is (2-methylquinolin-8-yl) 2,3-dimethyl-5-nitrobenzenesulfonate.
| Compound Name | (2-methylquinolin-8-yl) 2,3-dimethyl-5-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 26528996 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2-methylquinolin-8-yl) 2,3-dimethyl-5-nitrobenzenesulfonate |
| SMILES | Cc1ccc2cccc(OS(=O)(=O)c3cc([N+](=O)[O-])cc(C)c3C)c2n1 |
| InChI | InChI=1S/C18H16N2O5S/c1-11-9-15(20(21)22)10-17(13(11)3)26(23,24)25-16-6-4-5-14-8-7-12(2)19-18(14)16/h4-10H,1-3H3 |
| InChIKey | DVOSMKMKKZFICU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|