About ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate
ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate (PubChem CID 26529969) has the molecular formula C14H22N4O6S
and a molecular weight of 374.42 g/mol. Its IUPAC name is ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate |
| PubChem CID | 26529969 |
| Molecular Formula | C14H22N4O6S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NS(=O)(=O)c2cn(C)c(=O)n(C)c2=O)CC1 |
| InChI | InChI=1S/C14H22N4O6S/c1-4-24-14(21)18-7-5-10(6-8-18)15-25(22,23)11-9-16(2)13(20)17(3)12(11)19/h9-10,15H,4-8H2,1-3H3 |
| InChIKey | WNBQVCLUADGUQQ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate?
The IUPAC name of ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate (CID 26529969) is ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate is CCOC(=O)N1CCC(NS(=O)(=O)c2cn(C)c(=O)n(C)c2=O)CC1.
What is the InChIKey of ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate?
The InChIKey is WNBQVCLUADGUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O6S/c1-4-24-14(21)18-7-5-10(6-8-18)15-25(22,23)11-9-16(2)13(20)17(3)12(11)19/h9-10,15H,4-8H2,1-3H3.
What are the key properties of ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate?
ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate has a molecular weight of 374.42 g/mol, XLogP of -1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(1,3-dimethyl-2,4-dioxopyrimidin-5-yl)sulfonylamino]piperidine-1-carboxylate is sourced from PubChem (CID 26529969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).