C25H24N2O4S — CID 26532556
4-[(E)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxoprop-1-enyl]-N-(2-methoxyphenyl)benzenesulfonamide (PubChem CID 26532556) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-[(E)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxoprop-1-enyl]-N-(2-methoxyphenyl)benzenesulfonamide.
| Compound Name | 4-[(E)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxoprop-1-enyl]-N-(2-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 26532556 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[(E)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-3-oxoprop-1-enyl]-N-(2-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(/C=C/C(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C25H24N2O4S/c1-31-24-9-5-4-8-23(24)26-32(29,30)22-13-10-19(11-14-22)12-15-25(28)27-17-16-20-6-2-3-7-21(20)18-27/h2-15,26H,16-18H2,1H3/b15-12+ |
| InChIKey | HXYDBEXOXUDNDF-NTCAYCPXSA-N |
| XLogP | 4.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|