C22H28FN3O3S — CID 26535171
3-(4-benzylpiperazine-1-carbonyl)-N,N-diethyl-4-fluorobenzenesulfonamide (PubChem CID 26535171) has the molecular formula C22H28FN3O3S and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-(4-benzylpiperazine-1-carbonyl)-N,N-diethyl-4-fluorobenzenesulfonamide.
| Compound Name | 3-(4-benzylpiperazine-1-carbonyl)-N,N-diethyl-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 26535171 |
| Molecular Formula | C22H28FN3O3S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 3-(4-benzylpiperazine-1-carbonyl)-N,N-diethyl-4-fluorobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H28FN3O3S/c1-3-26(4-2)30(28,29)19-10-11-21(23)20(16-19)22(27)25-14-12-24(13-15-25)17-18-8-6-5-7-9-18/h5-11,16H,3-4,12-15,17H2,1-2H3 |
| InChIKey | AKUOIFGBXRCSIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |