C20H23F2N3O3S — CID 26535228
N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-3,4-difluorobenzenesulfonamide (PubChem CID 26535228) has the molecular formula C20H23F2N3O3S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-3,4-difluorobenzenesulfonamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 26535228 |
| Molecular Formula | C20H23F2N3O3S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-3,4-difluorobenzenesulfonamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)c(F)c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23F2N3O3S/c21-18-7-6-17(14-19(18)22)29(27,28)23-9-8-20(26)25-12-10-24(11-13-25)15-16-4-2-1-3-5-16/h1-7,14,23H,8-13,15H2 |
| InChIKey | WTDBHQFTTCEDJY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |