About 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea
1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea (PubChem CID 26536532) has the molecular formula C16H31N3OS
and a molecular weight of 313.51 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea.
Molecular Properties
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea |
| PubChem CID | 26536532 |
| Molecular Formula | C16H31N3OS |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C16H31N3OS/c1-13-6-4-5-7-14(13)18-15(21)17-12-16(2,3)19-8-10-20-11-9-19/h13-14H,4-12H2,1-3H3,(H2,17,18,21)/t13-,14+/m1/s1 |
| InChIKey | GXZAXMDENYFWGV-KGLIPLIRSA-N |
| XLogP | 2.14 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea?
The IUPAC name of 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea (CID 26536532) is 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea.
What is the SMILES notation for 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea?
The canonical SMILES for 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea is C[C@@H]1CCCC[C@@H]1NC(=S)NCC(C)(C)N1CCOCC1.
What is the InChIKey of 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea?
The InChIKey is GXZAXMDENYFWGV-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H31N3OS/c1-13-6-4-5-7-14(13)18-15(21)17-12-16(2,3)19-8-10-20-11-9-19/h13-14H,4-12H2,1-3H3,(H2,17,18,21)/t13-,14+/m1/s1.
What are the key properties of 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea?
1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea has a molecular weight of 313.51 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-2-morpholin-4-ylpropyl)thiourea is sourced from PubChem (CID 26536532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).