C22H29FN3O+ — CID 2654094
2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide (PubChem CID 2654094) has the molecular formula C22H29FN3O+ and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 2654094 |
| Molecular Formula | C22H29FN3O+ |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H28FN3O/c1-16(2)18-8-6-7-17(3)22(18)24-21(27)15-25-11-13-26(14-12-25)20-10-5-4-9-19(20)23/h4-10,16H,11-15H2,1-3H3,(H,24,27)/p+1 |
| InChIKey | HZWOVBFKWQEZCJ-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |