C16H16N2O4S2 — CID 26540985
4-cyano-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide (PubChem CID 26540985) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 4-cyano-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26540985 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 4-cyano-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]benzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(C#N)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16N2O4S2/c1-12(14-5-9-15(10-6-14)23(2,19)20)18-24(21,22)16-7-3-13(11-17)4-8-16/h3-10,12,18H,1-2H3/t12-/m1/s1 |
| InChIKey | LFYPBQCWTYVUGH-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |