C20H22N2O3S — CID 26545265
N-(2,2-diphenylpropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 26545265) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is N-(2,2-diphenylpropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(2,2-diphenylpropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 26545265 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(2,2-diphenylpropyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCC(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O3S/c1-15-19(16(2)25-22-15)26(23,24)21-14-20(3,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,21H,14H2,1-3H3 |
| InChIKey | MHYCHSSIRZBXNZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |