C20H22N4O2 — CID 2654878
(2R)-N-(4-cyanophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]propanamide (PubChem CID 2654878) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is (2R)-N-(4-cyanophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(4-cyanophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 2654878 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (2R)-N-(4-cyanophenyl)-2-[4-(2-hydroxyphenyl)piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(C#N)cc1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C20H22N4O2/c1-15(20(26)22-17-8-6-16(14-21)7-9-17)23-10-12-24(13-11-23)18-4-2-3-5-19(18)25/h2-9,15,25H,10-13H2,1H3,(H,22,26)/t15-/m1/s1 |
| InChIKey | PMMIZEOAJREFHO-OAHLLOKOSA-N |
| XLogP | 2.41 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |