C18H14N2OS2 — CID 26550364
2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(1H-indol-3-yl)ethanone (PubChem CID 26550364) has the molecular formula C18H14N2OS2 and a molecular weight of 338.46 g/mol. Its IUPAC name is 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 26550364 |
| Molecular Formula | C18H14N2OS2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 2-(4H-3,1-benzothiazin-2-ylsulfanyl)-1-(1H-indol-3-yl)ethanone |
| SMILES | O=C(CSC1=Nc2ccccc2CS1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H14N2OS2/c21-17(14-9-19-16-8-4-2-6-13(14)16)11-23-18-20-15-7-3-1-5-12(15)10-22-18/h1-9,19H,10-11H2 |
| InChIKey | UPLCNFRDDSCFEK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |