C18H14N2O4S — CID 26550756
3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one (PubChem CID 26550756) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 26550756 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
| SMILES | Cc1cc2oc(=O)cc(Cn3nc(-c4cccs4)oc3=O)c2cc1C |
| InChI | InChI=1S/C18H14N2O4S/c1-10-6-13-12(8-16(21)23-14(13)7-11(10)2)9-20-18(22)24-17(19-20)15-4-3-5-25-15/h3-8H,9H2,1-2H3 |
| InChIKey | XFGKFZAKGLHCPK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|