C18H21N3O5S2 — CID 26554394
(5-nitrothiophen-2-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 26554394) has the molecular formula C18H21N3O5S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is (5-nitrothiophen-2-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (5-nitrothiophen-2-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26554394 |
| Molecular Formula | C18H21N3O5S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | (5-nitrothiophen-2-yl)-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc([N+](=O)[O-])s3)CC2)cc1 |
| InChI | InChI=1S/C18H21N3O5S2/c1-13(2)14-3-5-15(6-4-14)28(25,26)20-11-9-19(10-12-20)18(22)16-7-8-17(27-16)21(23)24/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | YOQASXBTNPZFPS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|