About 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one
4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one (PubChem CID 2655740) has the molecular formula C24H28N2O4S
and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one.
Molecular Properties
| Compound Name | 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one |
| PubChem CID | 2655740 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(Cc3cc(=O)oc4c(C)c(C)ccc34)CC2)c1 |
| InChI | InChI=1S/C24H28N2O4S/c1-16-5-6-18(3)22(13-16)31(28,29)26-11-9-25(10-12-26)15-20-14-23(27)30-24-19(4)17(2)7-8-21(20)24/h5-8,13-14H,9-12,15H2,1-4H3 |
| InChIKey | NDXKAACOMWBTAI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one?
The IUPAC name of 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one (CID 2655740) is 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one.
What is the SMILES notation for 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one?
The canonical SMILES for 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one is Cc1ccc(C)c(S(=O)(=O)N2CCN(Cc3cc(=O)oc4c(C)c(C)ccc34)CC2)c1.
What is the InChIKey of 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one?
The InChIKey is NDXKAACOMWBTAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O4S/c1-16-5-6-18(3)22(13-16)31(28,29)26-11-9-25(10-12-26)15-20-14-23(27)30-24-19(4)17(2)7-8-21(20)24/h5-8,13-14H,9-12,15H2,1-4H3.
What are the key properties of 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one?
4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one has a molecular weight of 440.57 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one is sourced from PubChem (CID 2655740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).