C20H23FNO+ — CID 26564
4-(4-azoniatricyclo[5.2.2.02,6]undeca-3,8-dien-4-yl)-1-(4-fluorophenyl)butan-1-one (PubChem CID 26564) has the molecular formula C20H23FNO+ and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-(4-azoniatricyclo[5.2.2.02,6]undeca-3,8-dien-4-yl)-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-(4-azoniatricyclo[5.2.2.02,6]undeca-3,8-dien-4-yl)-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 26564 |
| Molecular Formula | C20H23FNO+ |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 4-(4-azoniatricyclo[5.2.2.02,6]undeca-3,8-dien-4-yl)-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCC[N+]1=CC2C3C=CC(CC3)C2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FNO/c21-17-9-7-16(8-10-17)20(23)2-1-11-22-12-18-14-3-4-15(6-5-14)19(18)13-22/h3-4,7-10,12,14-15,18-19H,1-2,5-6,11,13H2/q+1 |
| InChIKey | PCJHZZHLUJRZJR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|