C20H22N4O3S2 — CID 26569533
N,N-dimethyl-1-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 26569533) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is N,N-dimethyl-1-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N,N-dimethyl-1-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 26569533 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N,N-dimethyl-1-[(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc2c(c1)CCN2Cc1nc2sc3c(c2c(=O)[nH]1)CCC3 |
| InChI | InChI=1S/C20H22N4O3S2/c1-23(2)29(26,27)13-6-7-15-12(10-13)8-9-24(15)11-17-21-19(25)18-14-4-3-5-16(14)28-20(18)22-17/h6-7,10H,3-5,8-9,11H2,1-2H3,(H,21,22,25) |
| InChIKey | QXOMXXLCAZVXFW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |