C22H19N3O4S — CID 26584159
N-(3-acetamidophenyl)-4-(4-methylphenyl)sulfanyl-3-nitrobenzamide (PubChem CID 26584159) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-4-(4-methylphenyl)sulfanyl-3-nitrobenzamide.
| Compound Name | N-(3-acetamidophenyl)-4-(4-methylphenyl)sulfanyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 26584159 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-(3-acetamidophenyl)-4-(4-methylphenyl)sulfanyl-3-nitrobenzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2ccc(Sc3ccc(C)cc3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H19N3O4S/c1-14-6-9-19(10-7-14)30-21-11-8-16(12-20(21)25(28)29)22(27)24-18-5-3-4-17(13-18)23-15(2)26/h3-13H,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | UYUQKTNQRASKCB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|