C24H20FN5O2 — CID 26586837
N'-(cyclopropanecarbonyl)-1-[(3-fluorophenyl)methyl]-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 26586837) has the molecular formula C24H20FN5O2 and a molecular weight of 429.46 g/mol. Its IUPAC name is N'-(cyclopropanecarbonyl)-1-[(3-fluorophenyl)methyl]-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(cyclopropanecarbonyl)-1-[(3-fluorophenyl)methyl]-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 26586837 |
| Molecular Formula | C24H20FN5O2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N'-(cyclopropanecarbonyl)-1-[(3-fluorophenyl)methyl]-6-phenylpyrazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC1)c1cc(-c2ccccc2)nc2c1cnn2Cc1cccc(F)c1 |
| InChI | InChI=1S/C24H20FN5O2/c25-18-8-4-5-15(11-18)14-30-22-20(13-26-30)19(24(32)29-28-23(31)17-9-10-17)12-21(27-22)16-6-2-1-3-7-16/h1-8,11-13,17H,9-10,14H2,(H,28,31)(H,29,32) |
| InChIKey | FDVPWZMEMMXWOY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|