C25H25FN2O4S — CID 26590795
[4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate (PubChem CID 26590795) has the molecular formula C25H25FN2O4S and a molecular weight of 468.55 g/mol. Its IUPAC name is [4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate.
| Compound Name | [4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 26590795 |
| Molecular Formula | C25H25FN2O4S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [4-[4-(2-fluorophenyl)piperazine-1-carbonyl]phenyl] 2,5-dimethylbenzenesulfonate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccc(C(=O)N3CCN(c4ccccc4F)CC3)cc2)c1 |
| InChI | InChI=1S/C25H25FN2O4S/c1-18-7-8-19(2)24(17-18)33(30,31)32-21-11-9-20(10-12-21)25(29)28-15-13-27(14-16-28)23-6-4-3-5-22(23)26/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | HUJRPAANYPPGJS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|