C19H16F3NO3 — CID 26594339
(E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide (PubChem CID 26594339) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 26594339 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3NO3/c20-19(21,22)15-5-1-13(2-6-15)9-10-23-18(24)8-4-14-3-7-16-17(11-14)26-12-25-16/h1-8,11H,9-10,12H2,(H,23,24)/b8-4+ |
| InChIKey | DLNLCYALPJJNGZ-XBXARRHUSA-N |
| XLogP | 3.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|