C14H20O — CID 26595070
cis-(1R,2R)-2-(4-propylphenyl)cyclopentan-1-ol (PubChem CID 26595070) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is cis-(1R,2R)-2-(4-propylphenyl)cyclopentan-1-ol.
| Compound Name | cis-(1R,2R)-2-(4-propylphenyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 26595070 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | cis-(1R,2R)-2-(4-propylphenyl)cyclopentan-1-ol |
| SMILES | CCCc1ccc([C@H]2CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C14H20O/c1-2-4-11-7-9-12(10-8-11)13-5-3-6-14(13)15/h7-10,13-15H,2-6H2,1H3/t13-,14-/m1/s1 |
| InChIKey | HRZSRRCZFGFOAG-ZIAGYGMSSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |