(2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid

C3H2F6O3S — CID 26596721

IUPAC(2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid
SMILESO=S(=O)(O)C(F)(F)[C@H](F)C(F)(F)F
InChIInChI=1S/C3H2F6O3S/c4-1(2(5,6)7)3(8,9)13(10,11)12/h1H,(H,10,11,12)/t1-/m1/s1
InChIKeyDMOBTBZPQXBGRE-PVQJCKRUSA-N
MW232.10 g/mol
LogP1.37
Rot. Bonds2

About (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid

(2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 26596721) has the molecular formula C3H2F6O3S and a molecular weight of 232.10 g/mol. Its IUPAC name is (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid.

Molecular Properties

Compound Name(2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid
PubChem CID26596721
Molecular FormulaC3H2F6O3S
Molecular Weight232.10 g/mol
Exact Mass231.96
IUPAC Name(2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid
SMILESO=S(=O)(O)C(F)(F)[C@H](F)C(F)(F)F
InChIInChI=1S/C3H2F6O3S/c4-1(2(5,6)7)3(8,9)13(10,11)12/h1H,(H,10,11,12)/t1-/m1/s1
InChIKeyDMOBTBZPQXBGRE-PVQJCKRUSA-N
XLogP1.37
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.10
LogP ≤ 51.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Perfluorobutanesulfonic acid
CID 67815
Pentafluoroethanesulfonic acid
CID 10219841
1,1,2,2-Tetrafluoroethanesulfonic acid
CID 10176391
1h-Tetrafluoroethanesulfonic acid
CID 53438102
1,1,2,2,3,3,4,4-Octafluorobutane-1-sulphonic acid
CID 3018003
1-Propanesulfonic acid, 1,1,2,3,3,3-hexafluoro-
CID 9794628
Perfluoropropanesulfonic acid
CID 9859771
Pfsa-H; C4H2F8O3S
CID 59736185
5H-Perfluorohexanesulfonic acid
CID 139594766
4H-Perfluoropentanesulfonic acid
CID 139597747
HPFLSA_i n=3
CID 18402783
Heptafluoro-1-propanesulfinic acid
CID 22186452

Frequently Asked Questions

What is the IUPAC name of (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid?
The IUPAC name of (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid (CID 26596721) is (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid.
What is the SMILES notation for (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid?
The canonical SMILES for (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid is O=S(=O)(O)C(F)(F)[C@H](F)C(F)(F)F.
What is the InChIKey of (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid?
The InChIKey is DMOBTBZPQXBGRE-PVQJCKRUSA-N. The full InChI is InChI=1S/C3H2F6O3S/c4-1(2(5,6)7)3(8,9)13(10,11)12/h1H,(H,10,11,12)/t1-/m1/s1.
What are the key properties of (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid?
(2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid has a molecular weight of 232.10 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1,2,3,3,3-hexafluoropropane-1-sulfonic acid is sourced from PubChem (CID 26596721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).