About 2-bromo-1,3-difluoro-5-isothiocyanatobenzene
2-bromo-1,3-difluoro-5-isothiocyanatobenzene (PubChem CID 26599116) has the molecular formula C7H2BrF2NS
and a molecular weight of 250.07 g/mol. Its IUPAC name is 2-bromo-1,3-difluoro-5-isothiocyanatobenzene.
Molecular Properties
| Compound Name | 2-bromo-1,3-difluoro-5-isothiocyanatobenzene |
| PubChem CID | 26599116 |
| Molecular Formula | C7H2BrF2NS |
| Molecular Weight | 250.07 g/mol |
| Exact Mass | 248.91 |
| IUPAC Name | 2-bromo-1,3-difluoro-5-isothiocyanatobenzene |
| SMILES | Fc1cc(N=C=S)cc(F)c1Br |
| InChI | InChI=1S/C7H2BrF2NS/c8-7-5(9)1-4(11-3-12)2-6(7)10/h1-2H |
| InChIKey | UQVJUTRQHOWKSK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.07 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,3-difluoro-5-isothiocyanatobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-difluoro-5-isothiocyanatobenzene?
The IUPAC name of 2-bromo-1,3-difluoro-5-isothiocyanatobenzene (CID 26599116) is 2-bromo-1,3-difluoro-5-isothiocyanatobenzene.
What is the SMILES notation for 2-bromo-1,3-difluoro-5-isothiocyanatobenzene?
The canonical SMILES for 2-bromo-1,3-difluoro-5-isothiocyanatobenzene is Fc1cc(N=C=S)cc(F)c1Br.
What is the InChIKey of 2-bromo-1,3-difluoro-5-isothiocyanatobenzene?
The InChIKey is UQVJUTRQHOWKSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrF2NS/c8-7-5(9)1-4(11-3-12)2-6(7)10/h1-2H.
What are the key properties of 2-bromo-1,3-difluoro-5-isothiocyanatobenzene?
2-bromo-1,3-difluoro-5-isothiocyanatobenzene has a molecular weight of 250.07 g/mol, XLogP of 3.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-difluoro-5-isothiocyanatobenzene is sourced from PubChem (CID 26599116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).