About 2,4-dibromo-3,5-dichloroaniline
2,4-dibromo-3,5-dichloroaniline (PubChem CID 26599169) has the molecular formula C6H3Br2Cl2N
and a molecular weight of 319.81 g/mol. Its IUPAC name is 2,4-dibromo-3,5-dichloroaniline.
Molecular Properties
| Compound Name | 2,4-dibromo-3,5-dichloroaniline |
| PubChem CID | 26599169 |
| Molecular Formula | C6H3Br2Cl2N |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 316.80 |
| IUPAC Name | 2,4-dibromo-3,5-dichloroaniline |
| SMILES | Nc1cc(Cl)c(Br)c(Cl)c1Br |
| InChI | InChI=1S/C6H3Br2Cl2N/c7-4-2(9)1-3(11)5(8)6(4)10/h1H,11H2 |
| InChIKey | PVBANICCLVRNTM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-3,5-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-3,5-dichloroaniline?
The IUPAC name of 2,4-dibromo-3,5-dichloroaniline (CID 26599169) is 2,4-dibromo-3,5-dichloroaniline.
What is the SMILES notation for 2,4-dibromo-3,5-dichloroaniline?
The canonical SMILES for 2,4-dibromo-3,5-dichloroaniline is Nc1cc(Cl)c(Br)c(Cl)c1Br.
What is the InChIKey of 2,4-dibromo-3,5-dichloroaniline?
The InChIKey is PVBANICCLVRNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br2Cl2N/c7-4-2(9)1-3(11)5(8)6(4)10/h1H,11H2.
What are the key properties of 2,4-dibromo-3,5-dichloroaniline?
2,4-dibromo-3,5-dichloroaniline has a molecular weight of 319.81 g/mol, XLogP of 4.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-3,5-dichloroaniline is sourced from PubChem (CID 26599169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).