C24H22ClN3O5 — CID 26619673
4-(4-chloro-2-nitrophenoxy)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 26619673) has the molecular formula C24H22ClN3O5 and a molecular weight of 467.91 g/mol. Its IUPAC name is 4-(4-chloro-2-nitrophenoxy)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 4-(4-chloro-2-nitrophenoxy)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 26619673 |
| Molecular Formula | C24H22ClN3O5 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 4-(4-chloro-2-nitrophenoxy)-N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)c1ccc(Oc2ccc(Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H22ClN3O5/c1-15-5-4-6-16(2)23(15)26-22(29)14-27(3)24(30)17-7-10-19(11-8-17)33-21-12-9-18(25)13-20(21)28(31)32/h4-13H,14H2,1-3H3,(H,26,29) |
| InChIKey | QIMOITIEZIDDTM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|