C22H21ClN2O5S — CID 26620643
N-(4-chloro-2,5-dimethoxyphenyl)-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 26620643) has the molecular formula C22H21ClN2O5S and a molecular weight of 460.94 g/mol. Its IUPAC name is N-(4-chloro-2,5-dimethoxyphenyl)-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 26620643 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-(4-chloro-2,5-dimethoxyphenyl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | COc1cc(NC(=O)c2cccc(S(=O)(=O)Nc3ccc(C)cc3)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C22H21ClN2O5S/c1-14-7-9-16(10-8-14)25-31(27,28)17-6-4-5-15(11-17)22(26)24-19-13-20(29-2)18(23)12-21(19)30-3/h4-13,25H,1-3H3,(H,24,26) |
| InChIKey | CDWRIUKWLFQYIB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |